C14H12O7PS-3 — CID 56947013
2-(3-phenoxyphenyl)-1-phosphonatoethanesulfonate (PubChem CID 56947013) has the molecular formula C14H12O7PS-3 and a molecular weight of 355.28 g/mol. Its IUPAC name is 2-(3-phenoxyphenyl)-1-phosphonatoethanesulfonate.
| Compound Name | 2-(3-phenoxyphenyl)-1-phosphonatoethanesulfonate |
|---|---|
| PubChem CID | 56947013 |
| Molecular Formula | C14H12O7PS-3 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 2-(3-phenoxyphenyl)-1-phosphonatoethanesulfonate |
| SMILES | O=P([O-])([O-])C(Cc1cccc(Oc2ccccc2)c1)S(=O)(=O)[O-] |
| InChI | InChI=1S/C14H15O7PS/c15-22(16,17)14(23(18,19)20)10-11-5-4-8-13(9-11)21-12-6-2-1-3-7-12/h1-9,14H,10H2,(H2,15,16,17)(H,18,19,20)/p-3 |
| InChIKey | QZTDQEVQGQAOKB-UHFFFAOYSA-K |
| XLogP | 0.81 |
| TPSA | 129.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|