C38H35O15PS — CID 11274355
(1S)-1-[bis[[5-(4-methoxyphenyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphoryl]-4-(3-phenoxyphenyl)butane-1-sulfonic acid (PubChem CID 11274355) has the molecular formula C38H35O15PS and a molecular weight of 794.72 g/mol. Its IUPAC name is (1S)-1-[bis[[5-(4-methoxyphenyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphoryl]-4-(3-phenoxyphenyl)butane-1-sulfonic acid.
| Compound Name | (1S)-1-[bis[[5-(4-methoxyphenyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphoryl]-4-(3-phenoxyphenyl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 11274355 |
| Molecular Formula | C38H35O15PS |
| Molecular Weight | 794.72 g/mol |
| Exact Mass | 794.14 |
| IUPAC Name | (1S)-1-[bis[[5-(4-methoxyphenyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphoryl]-4-(3-phenoxyphenyl)butane-1-sulfonic acid |
| SMILES | COc1ccc(-c2oc(=O)oc2COP(=O)(OCc2oc(=O)oc2-c2ccc(OC)cc2)[C@H](CCCc2cccc(Oc3ccccc3)c2)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C38H35O15PS/c1-45-28-18-14-26(15-19-28)35-32(50-37(39)52-35)23-47-54(41,48-24-33-36(53-38(40)51-33)27-16-20-29(46-2)21-17-27)34(55(42,43)44)13-7-9-25-8-6-12-31(22-25)49-30-10-4-3-5-11-30/h3-6,8,10-12,14-22,34H,7,9,13,23-24H2,1-2H3,(H,42,43,44)/t34-/m0/s1 |
| InChIKey | KDFRRJUJJGZMQT-UMSFTDKQSA-N |
| XLogP | 8.09 |
| TPSA | 204.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.72 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|