C22H24N2O5 — CID 87108521
4-[2-[(4-cyclohex-2-en-1-yloxybenzoyl)amino]ethoxy]-N-hydroxybenzamide (PubChem CID 87108521) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 4-[2-[(4-cyclohex-2-en-1-yloxybenzoyl)amino]ethoxy]-N-hydroxybenzamide.
| Compound Name | 4-[2-[(4-cyclohex-2-en-1-yloxybenzoyl)amino]ethoxy]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 87108521 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 4-[2-[(4-cyclohex-2-en-1-yloxybenzoyl)amino]ethoxy]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(OCCNC(=O)c2ccc(OC3C=CCCC3)cc2)cc1 |
| InChI | InChI=1S/C22H24N2O5/c25-21(16-8-12-20(13-9-16)29-19-4-2-1-3-5-19)23-14-15-28-18-10-6-17(7-11-18)22(26)24-27/h2,4,6-13,19,27H,1,3,5,14-15H2,(H,23,25)(H,24,26) |
| InChIKey | XJFDTZOBHUGCRD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|