C19H22N2O2S — CID 22170550
4-cyclohex-2-en-1-yloxy-N-(5-propan-2-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 22170550) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is 4-cyclohex-2-en-1-yloxy-N-(5-propan-2-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-cyclohex-2-en-1-yloxy-N-(5-propan-2-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 22170550 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 4-cyclohex-2-en-1-yloxy-N-(5-propan-2-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | CC(C)c1cnc(NC(=O)c2ccc(OC3C=CCCC3)cc2)s1 |
| InChI | InChI=1S/C19H22N2O2S/c1-13(2)17-12-20-19(24-17)21-18(22)14-8-10-16(11-9-14)23-15-6-4-3-5-7-15/h4,6,8-13,15H,3,5,7H2,1-2H3,(H,20,21,22) |
| InChIKey | SUAUTWIJYKNXFI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|