C14H16N2OS2 — CID 22170516
4-methylsulfanyl-N-(5-propan-2-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 22170516) has the molecular formula C14H16N2OS2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 4-methylsulfanyl-N-(5-propan-2-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-methylsulfanyl-N-(5-propan-2-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 22170516 |
| Molecular Formula | C14H16N2OS2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-methylsulfanyl-N-(5-propan-2-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | CSc1ccc(C(=O)Nc2ncc(C(C)C)s2)cc1 |
| InChI | InChI=1S/C14H16N2OS2/c1-9(2)12-8-15-14(19-12)16-13(17)10-4-6-11(18-3)7-5-10/h4-9H,1-3H3,(H,15,16,17) |
| InChIKey | ASLHCQSMJYIINV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |