C15H18N2O2S — CID 22170489
4-ethoxy-N-(5-propan-2-yl-1,3-thiazol-2-yl)benzamide (PubChem CID 22170489) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 4-ethoxy-N-(5-propan-2-yl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-ethoxy-N-(5-propan-2-yl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 22170489 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-ethoxy-N-(5-propan-2-yl-1,3-thiazol-2-yl)benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ncc(C(C)C)s2)cc1 |
| InChI | InChI=1S/C15H18N2O2S/c1-4-19-12-7-5-11(6-8-12)14(18)17-15-16-9-13(20-15)10(2)3/h5-10H,4H2,1-3H3,(H,16,17,18) |
| InChIKey | WGFAOEAPVIIPDY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |