About butanedioic acid;oxepan-2-one
butanedioic acid;oxepan-2-one (PubChem CID 70165852) has the molecular formula C10H16O6
and a molecular weight of 232.23 g/mol. Its IUPAC name is butanedioic acid;oxepan-2-one.
Molecular Properties
| Compound Name | butanedioic acid;oxepan-2-one |
| PubChem CID | 70165852 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | butanedioic acid;oxepan-2-one |
| SMILES | O=C(O)CCC(=O)O.O=C1CCCCCO1 |
| InChI | InChI=1S/C6H10O2.C4H6O4/c7-6-4-2-1-3-5-8-6;5-3(6)1-2-4(7)8/h1-5H2;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | WGPUGWUVSYOBIQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze butanedioic acid;oxepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioic acid;oxepan-2-one?
The IUPAC name of butanedioic acid;oxepan-2-one (CID 70165852) is butanedioic acid;oxepan-2-one.
What is the SMILES notation for butanedioic acid;oxepan-2-one?
The canonical SMILES for butanedioic acid;oxepan-2-one is O=C(O)CCC(=O)O.O=C1CCCCCO1.
What is the InChIKey of butanedioic acid;oxepan-2-one?
The InChIKey is WGPUGWUVSYOBIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C4H6O4/c7-6-4-2-1-3-5-8-6;5-3(6)1-2-4(7)8/h1-5H2;1-2H2,(H,5,6)(H,7,8).
What are the key properties of butanedioic acid;oxepan-2-one?
butanedioic acid;oxepan-2-one has a molecular weight of 232.23 g/mol, XLogP of 1.04, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioic acid;oxepan-2-one is sourced from PubChem (CID 70165852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).