C20H23N — CID 1415531
N,N-diethyl-4,4-diphenylbut-2-yn-1-amine (PubChem CID 1415531) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is N,N-diethyl-4,4-diphenylbut-2-yn-1-amine.
| Compound Name | N,N-diethyl-4,4-diphenylbut-2-yn-1-amine |
|---|---|
| PubChem CID | 1415531 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N,N-diethyl-4,4-diphenylbut-2-yn-1-amine |
| SMILES | CCN(CC)CC#CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H23N/c1-3-21(4-2)17-11-16-20(18-12-7-5-8-13-18)19-14-9-6-10-15-19/h5-10,12-15,20H,3-4,17H2,1-2H3 |
| InChIKey | IGRUZQSJOFTRTG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|