C23H29NO2 — CID 98084110
[(E)-[(2R)-2-heptylcyclopentylidene]amino] naphthalene-1-carboxylate (PubChem CID 98084110) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is [(E)-[(2R)-2-heptylcyclopentylidene]amino] naphthalene-1-carboxylate.
| Compound Name | [(E)-[(2R)-2-heptylcyclopentylidene]amino] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 98084110 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | [(E)-[(2R)-2-heptylcyclopentylidene]amino] naphthalene-1-carboxylate |
| SMILES | CCCCCCC[C@@H]1CCC/C1=N\OC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H29NO2/c1-2-3-4-5-6-12-19-14-10-17-22(19)24-26-23(25)21-16-9-13-18-11-7-8-15-20(18)21/h7-9,11,13,15-16,19H,2-6,10,12,14,17H2,1H3/b24-22+/t19-/m1/s1 |
| InChIKey | GIJWEEYBTRYFAI-RSTPCFTMSA-N |
| XLogP | 6.51 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|