C23H35Cl2N3O — CID 98505233
4-[bis(2-chloroethyl)amino]-N-[(E)-[(2R)-2-heptylcyclopentylidene]amino]benzamide (PubChem CID 98505233) has the molecular formula C23H35Cl2N3O and a molecular weight of 440.46 g/mol. Its IUPAC name is 4-[bis(2-chloroethyl)amino]-N-[(E)-[(2R)-2-heptylcyclopentylidene]amino]benzamide.
| Compound Name | 4-[bis(2-chloroethyl)amino]-N-[(E)-[(2R)-2-heptylcyclopentylidene]amino]benzamide |
|---|---|
| PubChem CID | 98505233 |
| Molecular Formula | C23H35Cl2N3O |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 4-[bis(2-chloroethyl)amino]-N-[(E)-[(2R)-2-heptylcyclopentylidene]amino]benzamide |
| SMILES | CCCCCCC[C@@H]1CCC/C1=N\NC(=O)c1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C23H35Cl2N3O/c1-2-3-4-5-6-8-19-9-7-10-22(19)26-27-23(29)20-11-13-21(14-12-20)28(17-15-24)18-16-25/h11-14,19H,2-10,15-18H2,1H3,(H,27,29)/b26-22+/t19-/m1/s1 |
| InChIKey | KSBXSPHUDZRVJZ-MJOLOOBESA-N |
| XLogP | 6.22 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|