C20H28N2O3 — CID 7530183
trans-methyl (1R,2R,3E)-3-(benzoylhydrazinylidene)-2-hexylcyclopentane-1-carboxylate (PubChem CID 7530183) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is trans-methyl (1R,2R,3E)-3-(benzoylhydrazinylidene)-2-hexylcyclopentane-1-carboxylate.
| Compound Name | trans-methyl (1R,2R,3E)-3-(benzoylhydrazinylidene)-2-hexylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 7530183 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | trans-methyl (1R,2R,3E)-3-(benzoylhydrazinylidene)-2-hexylcyclopentane-1-carboxylate |
| SMILES | CCCCCC[C@H]1/C(=N/NC(=O)c2ccccc2)CC[C@H]1C(=O)OC |
| InChI | InChI=1S/C20H28N2O3/c1-3-4-5-9-12-16-17(20(24)25-2)13-14-18(16)21-22-19(23)15-10-7-6-8-11-15/h6-8,10-11,16-17H,3-5,9,12-14H2,1-2H3,(H,22,23)/b21-18+/t16-,17-/m1/s1 |
| InChIKey | BATQKXRPAFSNEO-HSLLHTKSSA-N |
| XLogP | 3.94 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|