C22H24N2O4 — CID 98084528
methyl (1S,2Z,4R,6R)-2-(benzoylhydrazinylidene)-4-hydroxy-4-methyl-6-phenylcyclohexane-1-carboxylate (PubChem CID 98084528) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is methyl (1S,2Z,4R,6R)-2-(benzoylhydrazinylidene)-4-hydroxy-4-methyl-6-phenylcyclohexane-1-carboxylate.
| Compound Name | methyl (1S,2Z,4R,6R)-2-(benzoylhydrazinylidene)-4-hydroxy-4-methyl-6-phenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 98084528 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | methyl (1S,2Z,4R,6R)-2-(benzoylhydrazinylidene)-4-hydroxy-4-methyl-6-phenylcyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1/C(=N\NC(=O)c2ccccc2)C[C@](C)(O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H24N2O4/c1-22(27)13-17(15-9-5-3-6-10-15)19(21(26)28-2)18(14-22)23-24-20(25)16-11-7-4-8-12-16/h3-12,17,19,27H,13-14H2,1-2H3,(H,24,25)/b23-18-/t17-,19-,22+/m0/s1 |
| InChIKey | UXDWCDGUZQAGFL-YCNGUUAMSA-N |
| XLogP | 2.89 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|