C22H24N2O5 — CID 71830963
methyl 4-hydroxy-2-[(2-hydroxybenzoyl)hydrazinylidene]-4-methyl-6-phenylcyclohexane-1-carboxylate (PubChem CID 71830963) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is methyl 4-hydroxy-2-[(2-hydroxybenzoyl)hydrazinylidene]-4-methyl-6-phenylcyclohexane-1-carboxylate.
| Compound Name | methyl 4-hydroxy-2-[(2-hydroxybenzoyl)hydrazinylidene]-4-methyl-6-phenylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 71830963 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | methyl 4-hydroxy-2-[(2-hydroxybenzoyl)hydrazinylidene]-4-methyl-6-phenylcyclohexane-1-carboxylate |
| SMILES | COC(=O)C1C(=NNC(=O)c2ccccc2O)CC(C)(O)CC1c1ccccc1 |
| InChI | InChI=1S/C22H24N2O5/c1-22(28)12-16(14-8-4-3-5-9-14)19(21(27)29-2)17(13-22)23-24-20(26)15-10-6-7-11-18(15)25/h3-11,16,19,25,28H,12-13H2,1-2H3,(H,24,26) |
| InChIKey | JPQOGYMVEBZUHB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|