C15H18N2O3 — CID 5183767
N-[(3,3-dimethyl-5-oxocyclohexylidene)amino]-2-hydroxybenzamide (PubChem CID 5183767) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-[(3,3-dimethyl-5-oxocyclohexylidene)amino]-2-hydroxybenzamide.
| Compound Name | N-[(3,3-dimethyl-5-oxocyclohexylidene)amino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 5183767 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-[(3,3-dimethyl-5-oxocyclohexylidene)amino]-2-hydroxybenzamide |
| SMILES | CC1(C)CC(=O)CC(=NNC(=O)c2ccccc2O)C1 |
| InChI | InChI=1S/C15H18N2O3/c1-15(2)8-10(7-11(18)9-15)16-17-14(20)12-5-3-4-6-13(12)19/h3-6,19H,7-9H2,1-2H3,(H,17,20) |
| InChIKey | RYRVYJATPSUNNL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|