C18H24N2O3 — CID 5419588
N-[(E)-(3,3-dimethyl-5-oxocyclohexylidene)amino]-2-(2,5-dimethylphenoxy)acetamide (PubChem CID 5419588) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[(E)-(3,3-dimethyl-5-oxocyclohexylidene)amino]-2-(2,5-dimethylphenoxy)acetamide.
| Compound Name | N-[(E)-(3,3-dimethyl-5-oxocyclohexylidene)amino]-2-(2,5-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 5419588 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N-[(E)-(3,3-dimethyl-5-oxocyclohexylidene)amino]-2-(2,5-dimethylphenoxy)acetamide |
| SMILES | Cc1ccc(C)c(OCC(=O)N/N=C2/CC(=O)CC(C)(C)C2)c1 |
| InChI | InChI=1S/C18H24N2O3/c1-12-5-6-13(2)16(7-12)23-11-17(22)20-19-14-8-15(21)10-18(3,4)9-14/h5-7H,8-11H2,1-4H3,(H,20,22)/b19-14- |
| InChIKey | ZSNPBVKSGXDLIG-RGEXLXHISA-N |
| XLogP | 2.93 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|