C22H25NO3 — CID 71830970
N-(2,4-dimethylphenyl)-4-hydroxy-4-methyl-2-oxo-6-phenylcyclohexane-1-carboxamide (PubChem CID 71830970) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4-hydroxy-4-methyl-2-oxo-6-phenylcyclohexane-1-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-4-hydroxy-4-methyl-2-oxo-6-phenylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 71830970 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4-hydroxy-4-methyl-2-oxo-6-phenylcyclohexane-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2C(=O)CC(C)(O)CC2c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C22H25NO3/c1-14-9-10-18(15(2)11-14)23-21(25)20-17(16-7-5-4-6-8-16)12-22(3,26)13-19(20)24/h4-11,17,20,26H,12-13H2,1-3H3,(H,23,25) |
| InChIKey | ZZCYFVLFXLNREF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|