C28H37NO4 — CID 3407443
[(6-hydroxy-5-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] 4-decoxybenzoate (PubChem CID 3407443) has the molecular formula C28H37NO4 and a molecular weight of 451.61 g/mol. Its IUPAC name is [(6-hydroxy-5-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] 4-decoxybenzoate.
| Compound Name | [(6-hydroxy-5-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] 4-decoxybenzoate |
|---|---|
| PubChem CID | 3407443 |
| Molecular Formula | C28H37NO4 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | [(6-hydroxy-5-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)ON=C2CCCc3c2ccc(O)c3C)cc1 |
| InChI | InChI=1S/C28H37NO4/c1-3-4-5-6-7-8-9-10-20-32-23-16-14-22(15-17-23)28(31)33-29-26-13-11-12-24-21(2)27(30)19-18-25(24)26/h14-19,30H,3-13,20H2,1-2H3 |
| InChIKey | SNJDLWKBZDNMNL-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|