C22H27NO6 — CID 5244989
[[4-oxo-3,5-di(propan-2-yl)cyclohexa-2,5-dien-1-ylidene]amino] 3,4,5-trimethoxybenzoate (PubChem CID 5244989) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is [[4-oxo-3,5-di(propan-2-yl)cyclohexa-2,5-dien-1-ylidene]amino] 3,4,5-trimethoxybenzoate.
| Compound Name | [[4-oxo-3,5-di(propan-2-yl)cyclohexa-2,5-dien-1-ylidene]amino] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 5244989 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | [[4-oxo-3,5-di(propan-2-yl)cyclohexa-2,5-dien-1-ylidene]amino] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)ON=C2C=C(C(C)C)C(=O)C(C(C)C)=C2)cc(OC)c1OC |
| InChI | InChI=1S/C22H27NO6/c1-12(2)16-10-15(11-17(13(3)4)20(16)24)23-29-22(25)14-8-18(26-5)21(28-7)19(9-14)27-6/h8-13H,1-7H3 |
| InChIKey | PRUHYFISNQCSEO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|