C19H20BrNO3 — CID 5244981
[[4-oxo-3,5-di(propan-2-yl)cyclohexa-2,5-dien-1-ylidene]amino] 4-bromobenzoate (PubChem CID 5244981) has the molecular formula C19H20BrNO3 and a molecular weight of 390.28 g/mol. Its IUPAC name is [[4-oxo-3,5-di(propan-2-yl)cyclohexa-2,5-dien-1-ylidene]amino] 4-bromobenzoate.
| Compound Name | [[4-oxo-3,5-di(propan-2-yl)cyclohexa-2,5-dien-1-ylidene]amino] 4-bromobenzoate |
|---|---|
| PubChem CID | 5244981 |
| Molecular Formula | C19H20BrNO3 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | [[4-oxo-3,5-di(propan-2-yl)cyclohexa-2,5-dien-1-ylidene]amino] 4-bromobenzoate |
| SMILES | CC(C)C1=CC(=NOC(=O)c2ccc(Br)cc2)C=C(C(C)C)C1=O |
| InChI | InChI=1S/C19H20BrNO3/c1-11(2)16-9-15(10-17(12(3)4)18(16)22)21-24-19(23)13-5-7-14(20)8-6-13/h5-12H,1-4H3 |
| InChIKey | LNHXPXJRULVFEJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|