About [3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]methanamine
[3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]methanamine (PubChem CID 116520913) has the molecular formula C14H20FNO2
and a molecular weight of 253.32 g/mol. Its IUPAC name is [3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]methanamine.
Molecular Properties
| Compound Name | [3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]methanamine |
| PubChem CID | 116520913 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | [3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]methanamine |
| SMILES | CC1(C)CCC(COc2cc(F)cc(CN)c2)O1 |
| InChI | InChI=1S/C14H20FNO2/c1-14(2)4-3-12(18-14)9-17-13-6-10(8-16)5-11(15)7-13/h5-7,12H,3-4,8-9,16H2,1-2H3 |
| InChIKey | YWHILIHWEYIKCN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]methanamine?
The IUPAC name of [3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]methanamine (CID 116520913) is [3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]methanamine.
What is the SMILES notation for [3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]methanamine?
The canonical SMILES for [3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]methanamine is CC1(C)CCC(COc2cc(F)cc(CN)c2)O1.
What is the InChIKey of [3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]methanamine?
The InChIKey is YWHILIHWEYIKCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20FNO2/c1-14(2)4-3-12(18-14)9-17-13-6-10(8-16)5-11(15)7-13/h5-7,12H,3-4,8-9,16H2,1-2H3.
What are the key properties of [3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]methanamine?
[3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]methanamine has a molecular weight of 253.32 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]methanamine is sourced from PubChem (CID 116520913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).