C17H21FO3 — CID 116523040
4-[3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]but-3-yn-1-ol (PubChem CID 116523040) has the molecular formula C17H21FO3 and a molecular weight of 292.35 g/mol. Its IUPAC name is 4-[3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]but-3-yn-1-ol.
| Compound Name | 4-[3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 116523040 |
| Molecular Formula | C17H21FO3 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 4-[3-[(5,5-dimethyloxolan-2-yl)methoxy]-5-fluorophenyl]but-3-yn-1-ol |
| SMILES | CC1(C)CCC(COc2cc(F)cc(C#CCCO)c2)O1 |
| InChI | InChI=1S/C17H21FO3/c1-17(2)7-6-15(21-17)12-20-16-10-13(5-3-4-8-19)9-14(18)11-16/h9-11,15,19H,4,6-8,12H2,1-2H3 |
| InChIKey | UBJGATLXMQIYOM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|