C13H17BF3O2- — CID 116522447
[2-[(5,5-dimethyloxolan-2-yl)methoxy]phenyl]-trifluoroboranuide (PubChem CID 116522447) has the molecular formula C13H17BF3O2- and a molecular weight of 273.08 g/mol. Its IUPAC name is [2-[(5,5-dimethyloxolan-2-yl)methoxy]phenyl]-trifluoroboranuide.
| Compound Name | [2-[(5,5-dimethyloxolan-2-yl)methoxy]phenyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 116522447 |
| Molecular Formula | C13H17BF3O2- |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | [2-[(5,5-dimethyloxolan-2-yl)methoxy]phenyl]-trifluoroboranuide |
| SMILES | CC1(C)CCC(COc2ccccc2[B-](F)(F)F)O1 |
| InChI | InChI=1S/C13H17BF3O2/c1-13(2)8-7-10(19-13)9-18-12-6-4-3-5-11(12)14(15,16)17/h3-6,10H,7-9H2,1-2H3/q-1 |
| InChIKey | XUUUTSXQZGOGKW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|