C15H20O5 — CID 116520653
2-[(5,5-dimethyloxolan-2-yl)methoxy]-3-methoxybenzoic acid (PubChem CID 116520653) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-[(5,5-dimethyloxolan-2-yl)methoxy]-3-methoxybenzoic acid.
| Compound Name | 2-[(5,5-dimethyloxolan-2-yl)methoxy]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 116520653 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-[(5,5-dimethyloxolan-2-yl)methoxy]-3-methoxybenzoic acid |
| SMILES | COc1cccc(C(=O)O)c1OCC1CCC(C)(C)O1 |
| InChI | InChI=1S/C15H20O5/c1-15(2)8-7-10(20-15)9-19-13-11(14(16)17)5-4-6-12(13)18-3/h4-6,10H,7-9H2,1-3H3,(H,16,17) |
| InChIKey | UKGZJQCOKUAFHU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |