C17H24O4 — CID 102898609
[3-methoxy-2-(1-oxaspiro[4.4]nonan-2-ylmethoxy)phenyl]methanol (PubChem CID 102898609) has the molecular formula C17H24O4 and a molecular weight of 292.37 g/mol. Its IUPAC name is [3-methoxy-2-(1-oxaspiro[4.4]nonan-2-ylmethoxy)phenyl]methanol.
| Compound Name | [3-methoxy-2-(1-oxaspiro[4.4]nonan-2-ylmethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 102898609 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [3-methoxy-2-(1-oxaspiro[4.4]nonan-2-ylmethoxy)phenyl]methanol |
| SMILES | COc1cccc(CO)c1OCC1CCC2(CCCC2)O1 |
| InChI | InChI=1S/C17H24O4/c1-19-15-6-4-5-13(11-18)16(15)20-12-14-7-10-17(21-14)8-2-3-9-17/h4-6,14,18H,2-3,7-12H2,1H3 |
| InChIKey | CHTSIVBCQQPIOU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |