C13H18FNO4S — CID 116522475
4-[(5,5-dimethyloxolan-2-yl)methoxy]-3-fluorobenzenesulfonamide (PubChem CID 116522475) has the molecular formula C13H18FNO4S and a molecular weight of 303.35 g/mol. Its IUPAC name is 4-[(5,5-dimethyloxolan-2-yl)methoxy]-3-fluorobenzenesulfonamide.
| Compound Name | 4-[(5,5-dimethyloxolan-2-yl)methoxy]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 116522475 |
| Molecular Formula | C13H18FNO4S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4-[(5,5-dimethyloxolan-2-yl)methoxy]-3-fluorobenzenesulfonamide |
| SMILES | CC1(C)CCC(COc2ccc(S(N)(=O)=O)cc2F)O1 |
| InChI | InChI=1S/C13H18FNO4S/c1-13(2)6-5-9(19-13)8-18-12-4-3-10(7-11(12)14)20(15,16)17/h3-4,7,9H,5-6,8H2,1-2H3,(H2,15,16,17) |
| InChIKey | IFIUHYYAYCHJLK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |