C16H17Br2NO2 — CID 102881723
3-[[2-bromo-4-(bromomethyl)-6-ethoxyphenoxy]methyl]-5-methylpyridine (PubChem CID 102881723) has the molecular formula C16H17Br2NO2 and a molecular weight of 415.13 g/mol. Its IUPAC name is 3-[[2-bromo-4-(bromomethyl)-6-ethoxyphenoxy]methyl]-5-methylpyridine.
| Compound Name | 3-[[2-bromo-4-(bromomethyl)-6-ethoxyphenoxy]methyl]-5-methylpyridine |
|---|---|
| PubChem CID | 102881723 |
| Molecular Formula | C16H17Br2NO2 |
| Molecular Weight | 415.13 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | 3-[[2-bromo-4-(bromomethyl)-6-ethoxyphenoxy]methyl]-5-methylpyridine |
| SMILES | CCOc1cc(CBr)cc(Br)c1OCc1cncc(C)c1 |
| InChI | InChI=1S/C16H17Br2NO2/c1-3-20-15-6-12(7-17)5-14(18)16(15)21-10-13-4-11(2)8-19-9-13/h4-6,8-9H,3,7,10H2,1-2H3 |
| InChIKey | PJCWEWHDDUNZIP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.13 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|