C13H17Br2NO — CID 113236618
(E)-N-[(3,5-dibromo-4-methoxyphenyl)methyl]pent-3-en-1-amine (PubChem CID 113236618) has the molecular formula C13H17Br2NO and a molecular weight of 363.09 g/mol. Its IUPAC name is (E)-N-[(3,5-dibromo-4-methoxyphenyl)methyl]pent-3-en-1-amine.
| Compound Name | (E)-N-[(3,5-dibromo-4-methoxyphenyl)methyl]pent-3-en-1-amine |
|---|---|
| PubChem CID | 113236618 |
| Molecular Formula | C13H17Br2NO |
| Molecular Weight | 363.09 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | (E)-N-[(3,5-dibromo-4-methoxyphenyl)methyl]pent-3-en-1-amine |
| SMILES | C/C=C/CCNCc1cc(Br)c(OC)c(Br)c1 |
| InChI | InChI=1S/C13H17Br2NO/c1-3-4-5-6-16-9-10-7-11(14)13(17-2)12(15)8-10/h3-4,7-8,16H,5-6,9H2,1-2H3/b4-3+ |
| InChIKey | DGAJIUGZQRSAFD-ONEGZZNKSA-N |
| XLogP | 4.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.09 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|