C17H28BrNO3 — CID 66534132
N-[(2-bromo-5-ethoxy-4-methoxyphenyl)methyl]-3-butoxypropan-1-amine (PubChem CID 66534132) has the molecular formula C17H28BrNO3 and a molecular weight of 374.32 g/mol. Its IUPAC name is N-[(2-bromo-5-ethoxy-4-methoxyphenyl)methyl]-3-butoxypropan-1-amine.
| Compound Name | N-[(2-bromo-5-ethoxy-4-methoxyphenyl)methyl]-3-butoxypropan-1-amine |
|---|---|
| PubChem CID | 66534132 |
| Molecular Formula | C17H28BrNO3 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-[(2-bromo-5-ethoxy-4-methoxyphenyl)methyl]-3-butoxypropan-1-amine |
| SMILES | CCCCOCCCNCc1cc(OCC)c(OC)cc1Br |
| InChI | InChI=1S/C17H28BrNO3/c1-4-6-9-21-10-7-8-19-13-14-11-17(22-5-2)16(20-3)12-15(14)18/h11-12,19H,4-10,13H2,1-3H3 |
| InChIKey | MFHZOBXBRUCFJF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|