C19H32BrNO3 — CID 66533789
N-[(2-bromo-5-ethoxy-4-propan-2-yloxyphenyl)methyl]-3-butoxypropan-1-amine (PubChem CID 66533789) has the molecular formula C19H32BrNO3 and a molecular weight of 402.37 g/mol. Its IUPAC name is N-[(2-bromo-5-ethoxy-4-propan-2-yloxyphenyl)methyl]-3-butoxypropan-1-amine.
| Compound Name | N-[(2-bromo-5-ethoxy-4-propan-2-yloxyphenyl)methyl]-3-butoxypropan-1-amine |
|---|---|
| PubChem CID | 66533789 |
| Molecular Formula | C19H32BrNO3 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-[(2-bromo-5-ethoxy-4-propan-2-yloxyphenyl)methyl]-3-butoxypropan-1-amine |
| SMILES | CCCCOCCCNCc1cc(OCC)c(OC(C)C)cc1Br |
| InChI | InChI=1S/C19H32BrNO3/c1-5-7-10-22-11-8-9-21-14-16-12-18(23-6-2)19(13-17(16)20)24-15(3)4/h12-13,15,21H,5-11,14H2,1-4H3 |
| InChIKey | FSFQCEWVYVSSGB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|