C16H28BrClN2O2 — CID 2960172
N-[(2-bromo-5-ethoxy-4-propoxyphenyl)methyl]-N',N'-dimethylethane-1,2-diamine;hydrochloride (PubChem CID 2960172) has the molecular formula C16H28BrClN2O2 and a molecular weight of 395.77 g/mol. Its IUPAC name is N-[(2-bromo-5-ethoxy-4-propoxyphenyl)methyl]-N',N'-dimethylethane-1,2-diamine;hydrochloride.
| Compound Name | N-[(2-bromo-5-ethoxy-4-propoxyphenyl)methyl]-N',N'-dimethylethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 2960172 |
| Molecular Formula | C16H28BrClN2O2 |
| Molecular Weight | 395.77 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | N-[(2-bromo-5-ethoxy-4-propoxyphenyl)methyl]-N',N'-dimethylethane-1,2-diamine;hydrochloride |
| SMILES | CCCOc1cc(Br)c(CNCCN(C)C)cc1OCC.Cl |
| InChI | InChI=1S/C16H27BrN2O2.ClH/c1-5-9-21-16-11-14(17)13(10-15(16)20-6-2)12-18-7-8-19(3)4;/h10-11,18H,5-9,12H2,1-4H3;1H |
| InChIKey | ARQFXTGKYMCYIR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.77 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|