C21H27BrN2O3 — CID 7027057
2-[5-bromo-2-methoxy-4-(propylaminomethyl)phenoxy]-N-(2-phenylethyl)acetamide (PubChem CID 7027057) has the molecular formula C21H27BrN2O3 and a molecular weight of 435.36 g/mol. Its IUPAC name is 2-[5-bromo-2-methoxy-4-(propylaminomethyl)phenoxy]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[5-bromo-2-methoxy-4-(propylaminomethyl)phenoxy]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 7027057 |
| Molecular Formula | C21H27BrN2O3 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-[5-bromo-2-methoxy-4-(propylaminomethyl)phenoxy]-N-(2-phenylethyl)acetamide |
| SMILES | CCCNCc1cc(OC)c(OCC(=O)NCCc2ccccc2)cc1Br |
| InChI | InChI=1S/C21H27BrN2O3/c1-3-10-23-14-17-12-19(26-2)20(13-18(17)22)27-15-21(25)24-11-9-16-7-5-4-6-8-16/h4-8,12-13,23H,3,9-11,14-15H2,1-2H3,(H,24,25) |
| InChIKey | JSYGLVYJSUOLGW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|