C21H26Cl2FNO3 — CID 66531698
5-[[2-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]pentan-1-ol (PubChem CID 66531698) has the molecular formula C21H26Cl2FNO3 and a molecular weight of 430.35 g/mol. Its IUPAC name is 5-[[2-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]pentan-1-ol.
| Compound Name | 5-[[2-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 66531698 |
| Molecular Formula | C21H26Cl2FNO3 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 5-[[2-chloro-4-[(2-chloro-4-fluorophenyl)methoxy]-5-ethoxyphenyl]methylamino]pentan-1-ol |
| SMILES | CCOc1cc(CNCCCCCO)c(Cl)cc1OCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C21H26Cl2FNO3/c1-2-27-20-10-16(13-25-8-4-3-5-9-26)19(23)12-21(20)28-14-15-6-7-17(24)11-18(15)22/h6-7,10-12,25-26H,2-5,8-9,13-14H2,1H3 |
| InChIKey | NDDWBJLLPWQQSM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|