C17H28ClNO3 — CID 66532393
5-[(2-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylamino]pentan-1-ol (PubChem CID 66532393) has the molecular formula C17H28ClNO3 and a molecular weight of 329.87 g/mol. Its IUPAC name is 5-[(2-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylamino]pentan-1-ol.
| Compound Name | 5-[(2-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 66532393 |
| Molecular Formula | C17H28ClNO3 |
| Molecular Weight | 329.87 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 5-[(2-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylamino]pentan-1-ol |
| SMILES | CCOc1cc(CNCCCCCO)c(Cl)cc1OC(C)C |
| InChI | InChI=1S/C17H28ClNO3/c1-4-21-16-10-14(12-19-8-6-5-7-9-20)15(18)11-17(16)22-13(2)3/h10-11,13,19-20H,4-9,12H2,1-3H3 |
| InChIKey | IAEWSQHLWHRMCZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.87 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|