C20H27BrN2O2 — CID 66538646
N-[(6-bromo-3-methoxy-2-phenylmethoxyphenyl)methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 66538646) has the molecular formula C20H27BrN2O2 and a molecular weight of 407.35 g/mol. Its IUPAC name is N-[(6-bromo-3-methoxy-2-phenylmethoxyphenyl)methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[(6-bromo-3-methoxy-2-phenylmethoxyphenyl)methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 66538646 |
| Molecular Formula | C20H27BrN2O2 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-[(6-bromo-3-methoxy-2-phenylmethoxyphenyl)methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | COc1ccc(Br)c(CNCCCN(C)C)c1OCc1ccccc1 |
| InChI | InChI=1S/C20H27BrN2O2/c1-23(2)13-7-12-22-14-17-18(21)10-11-19(24-3)20(17)25-15-16-8-5-4-6-9-16/h4-6,8-11,22H,7,12-15H2,1-3H3 |
| InChIKey | NXEBFGBPDUZWES-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|