C18H19BrN4O2S — CID 66544100
4-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-1H-1,2,4-triazole-5-thione (PubChem CID 66544100) has the molecular formula C18H19BrN4O2S and a molecular weight of 435.35 g/mol. Its IUPAC name is 4-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 66544100 |
| Molecular Formula | C18H19BrN4O2S |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 4-[[6-bromo-3-methoxy-2-[(4-methylphenyl)methoxy]phenyl]methylamino]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(Br)c(CNn2cn[nH]c2=S)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C18H19BrN4O2S/c1-12-3-5-13(6-4-12)10-25-17-14(15(19)7-8-16(17)24-2)9-21-23-11-20-22-18(23)26/h3-8,11,21H,9-10H2,1-2H3,(H,22,26) |
| InChIKey | DLBZHIYWRJMLDT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|