C12H16N4O3S — CID 4725503
4-[(2,3,4-trimethoxyphenyl)methylamino]-1H-1,2,4-triazole-5-thione (PubChem CID 4725503) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 4-[(2,3,4-trimethoxyphenyl)methylamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(2,3,4-trimethoxyphenyl)methylamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4725503 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 4-[(2,3,4-trimethoxyphenyl)methylamino]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(CNn2cn[nH]c2=S)c(OC)c1OC |
| InChI | InChI=1S/C12H16N4O3S/c1-17-9-5-4-8(10(18-2)11(9)19-3)6-14-16-7-13-15-12(16)20/h4-5,7,14H,6H2,1-3H3,(H,15,20) |
| InChIKey | HVZGUZXRBFBWBA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 73.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|