C12H15BrN4O2S — CID 4727771
4-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylamino]-1H-1,2,4-triazole-5-thione (PubChem CID 4727771) has the molecular formula C12H15BrN4O2S and a molecular weight of 359.25 g/mol. Its IUPAC name is 4-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4727771 |
| Molecular Formula | C12H15BrN4O2S |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 4-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylamino]-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1cc(CNn2cn[nH]c2=S)cc(Br)c1OC |
| InChI | InChI=1S/C12H15BrN4O2S/c1-3-19-10-5-8(4-9(13)11(10)18-2)6-15-17-7-14-16-12(17)20/h4-5,7,15H,3,6H2,1-2H3,(H,16,20) |
| InChIKey | HUZCNHUETNEBQD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|