C18H17BrCl2N4O2S — CID 66541341
4-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]-1H-1,2,4-triazole-5-thione (PubChem CID 66541341) has the molecular formula C18H17BrCl2N4O2S and a molecular weight of 504.24 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 66541341 |
| Molecular Formula | C18H17BrCl2N4O2S |
| Molecular Weight | 504.24 g/mol |
| Exact Mass | 501.96 |
| IUPAC Name | 4-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1cc(CNn2cn[nH]c2=S)c(Br)cc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H17BrCl2N4O2S/c1-2-26-16-6-12(8-23-25-10-22-24-18(25)28)13(19)7-17(16)27-9-11-3-4-14(20)15(21)5-11/h3-7,10,23H,2,8-9H2,1H3,(H,24,28) |
| InChIKey | PLADDTVDGBIITJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.24 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|