C20H24BrCl2NO3 — CID 66533528
4-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]butan-1-ol (PubChem CID 66533528) has the molecular formula C20H24BrCl2NO3 and a molecular weight of 477.23 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]butan-1-ol.
| Compound Name | 4-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 66533528 |
| Molecular Formula | C20H24BrCl2NO3 |
| Molecular Weight | 477.23 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | 4-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]butan-1-ol |
| SMILES | CCOc1cc(CNCCCCO)c(Br)cc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H24BrCl2NO3/c1-2-26-19-10-15(12-24-7-3-4-8-25)16(21)11-20(19)27-13-14-5-6-17(22)18(23)9-14/h5-6,9-11,24-25H,2-4,7-8,12-13H2,1H3 |
| InChIKey | MLUHYSNSBFGLSC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.23 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|