C23H32BrClN2O2 — CID 66537828
N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 66537828) has the molecular formula C23H32BrClN2O2 and a molecular weight of 483.88 g/mol. Its IUPAC name is N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 66537828 |
| Molecular Formula | C23H32BrClN2O2 |
| Molecular Weight | 483.88 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | N-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCOc1cc(CNCCCN(CC)CC)c(Br)cc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H32BrClN2O2/c1-4-27(5-2)13-7-12-26-16-19-14-22(28-6-3)23(15-21(19)24)29-17-18-8-10-20(25)11-9-18/h8-11,14-15,26H,4-7,12-13,16-17H2,1-3H3 |
| InChIKey | GWZYDKVQBPZBAW-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.88 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|