C22H28BrCl2NO2 — CID 66533757
N-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]hexan-1-amine (PubChem CID 66533757) has the molecular formula C22H28BrCl2NO2 and a molecular weight of 489.28 g/mol. Its IUPAC name is N-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]hexan-1-amine.
| Compound Name | N-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]hexan-1-amine |
|---|---|
| PubChem CID | 66533757 |
| Molecular Formula | C22H28BrCl2NO2 |
| Molecular Weight | 489.28 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | N-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]hexan-1-amine |
| SMILES | CCCCCCNCc1cc(OCC)c(OCc2ccc(Cl)c(Cl)c2)cc1Br |
| InChI | InChI=1S/C22H28BrCl2NO2/c1-3-5-6-7-10-26-14-17-12-21(27-4-2)22(13-18(17)23)28-15-16-8-9-19(24)20(25)11-16/h8-9,11-13,26H,3-7,10,14-15H2,1-2H3 |
| InChIKey | BBJCHTHBUKTTEM-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.28 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|