C22H30BrNO2 — CID 66535078
N-[[2-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]hexan-1-amine (PubChem CID 66535078) has the molecular formula C22H30BrNO2 and a molecular weight of 420.39 g/mol. Its IUPAC name is N-[[2-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]hexan-1-amine.
| Compound Name | N-[[2-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]hexan-1-amine |
|---|---|
| PubChem CID | 66535078 |
| Molecular Formula | C22H30BrNO2 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-[[2-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]hexan-1-amine |
| SMILES | CCCCCCNCc1cc(OC)c(OCc2cccc(C)c2)cc1Br |
| InChI | InChI=1S/C22H30BrNO2/c1-4-5-6-7-11-24-15-19-13-21(25-3)22(14-20(19)23)26-16-18-10-8-9-17(2)12-18/h8-10,12-14,24H,4-7,11,15-16H2,1-3H3 |
| InChIKey | MKQOYIMFVAMAON-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|