C22H28BrNO2 — CID 66534993
N-[[2-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]cyclohexanamine (PubChem CID 66534993) has the molecular formula C22H28BrNO2 and a molecular weight of 418.38 g/mol. Its IUPAC name is N-[[2-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]cyclohexanamine.
| Compound Name | N-[[2-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]cyclohexanamine |
|---|---|
| PubChem CID | 66534993 |
| Molecular Formula | C22H28BrNO2 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-[[2-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]cyclohexanamine |
| SMILES | COc1cc(CNC2CCCCC2)c(Br)cc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C22H28BrNO2/c1-16-7-6-8-17(11-16)15-26-22-13-20(23)18(12-21(22)25-2)14-24-19-9-4-3-5-10-19/h6-8,11-13,19,24H,3-5,9-10,14-15H2,1-2H3 |
| InChIKey | WCEVHJJHRITHJJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |