C19H22BrNO2 — CID 66534972
N-[[2-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]cyclopropanamine (PubChem CID 66534972) has the molecular formula C19H22BrNO2 and a molecular weight of 376.29 g/mol. Its IUPAC name is N-[[2-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 66534972 |
| Molecular Formula | C19H22BrNO2 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | N-[[2-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methyl]cyclopropanamine |
| SMILES | COc1cc(CNC2CC2)c(Br)cc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C19H22BrNO2/c1-13-4-3-5-14(8-13)12-23-19-10-17(20)15(9-18(19)22-2)11-21-16-6-7-16/h3-5,8-10,16,21H,6-7,11-12H2,1-2H3 |
| InChIKey | RSUYGQVBRATJTH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |