C19H22Cl3NO3 — CID 66530581
4-[[2-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylamino]butan-1-ol (PubChem CID 66530581) has the molecular formula C19H22Cl3NO3 and a molecular weight of 418.75 g/mol. Its IUPAC name is 4-[[2-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylamino]butan-1-ol.
| Compound Name | 4-[[2-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 66530581 |
| Molecular Formula | C19H22Cl3NO3 |
| Molecular Weight | 418.75 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 4-[[2-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylamino]butan-1-ol |
| SMILES | COc1cc(CNCCCCO)c(Cl)cc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H22Cl3NO3/c1-25-18-9-14(11-23-6-2-3-7-24)16(21)10-19(18)26-12-13-4-5-15(20)17(22)8-13/h4-5,8-10,23-24H,2-3,6-7,11-12H2,1H3 |
| InChIKey | FTRLEAFQGYLKBT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.75 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|