C24H21BrCl2N4O2S — CID 66541270
4-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 66541270) has the molecular formula C24H21BrCl2N4O2S and a molecular weight of 580.34 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 66541270 |
| Molecular Formula | C24H21BrCl2N4O2S |
| Molecular Weight | 580.34 g/mol |
| Exact Mass | 577.99 |
| IUPAC Name | 4-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1cc(CNn2c(-c3ccccc3)n[nH]c2=S)c(Br)cc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H21BrCl2N4O2S/c1-2-32-21-11-17(13-28-31-23(29-30-24(31)34)16-6-4-3-5-7-16)18(25)12-22(21)33-14-15-8-9-19(26)20(27)10-15/h3-12,28H,2,13-14H2,1H3,(H,30,34) |
| InChIKey | YPUNWNCTYITBJQ-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.34 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|