C24H23BrN4O2S — CID 66543116
4-[[2-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 66543116) has the molecular formula C24H23BrN4O2S and a molecular weight of 511.45 g/mol. Its IUPAC name is 4-[[2-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[2-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 66543116 |
| Molecular Formula | C24H23BrN4O2S |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 510.07 |
| IUPAC Name | 4-[[2-bromo-5-methoxy-4-[(2-methylphenyl)methoxy]phenyl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cc(CNn2c(-c3ccccc3)n[nH]c2=S)c(Br)cc1OCc1ccccc1C |
| InChI | InChI=1S/C24H23BrN4O2S/c1-16-8-6-7-11-18(16)15-31-22-13-20(25)19(12-21(22)30-2)14-26-29-23(27-28-24(29)32)17-9-4-3-5-10-17/h3-13,26H,14-15H2,1-2H3,(H,28,32) |
| InChIKey | RFYGOBIHSRPMGP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|