C19H21BrN4O3S — CID 66541527
4-[(2-bromo-5-ethoxy-4-methoxyphenyl)methylamino]-3-(2-methoxyphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 66541527) has the molecular formula C19H21BrN4O3S and a molecular weight of 465.37 g/mol. Its IUPAC name is 4-[(2-bromo-5-ethoxy-4-methoxyphenyl)methylamino]-3-(2-methoxyphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(2-bromo-5-ethoxy-4-methoxyphenyl)methylamino]-3-(2-methoxyphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 66541527 |
| Molecular Formula | C19H21BrN4O3S |
| Molecular Weight | 465.37 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 4-[(2-bromo-5-ethoxy-4-methoxyphenyl)methylamino]-3-(2-methoxyphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1cc(CNn2c(-c3ccccc3OC)n[nH]c2=S)c(Br)cc1OC |
| InChI | InChI=1S/C19H21BrN4O3S/c1-4-27-17-9-12(14(20)10-16(17)26-3)11-21-24-18(22-23-19(24)28)13-7-5-6-8-15(13)25-2/h5-10,21H,4,11H2,1-3H3,(H,23,28) |
| InChIKey | XEWOGQNBTFKWRT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 73.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|