C23H19BrCl2N4O2S — CID 66545021
4-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 66545021) has the molecular formula C23H19BrCl2N4O2S and a molecular weight of 566.31 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 66545021 |
| Molecular Formula | C23H19BrCl2N4O2S |
| Molecular Weight | 566.31 g/mol |
| Exact Mass | 563.98 |
| IUPAC Name | 4-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cc(CNn2c(-c3ccccc3)n[nH]c2=S)c(Br)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H19BrCl2N4O2S/c1-31-20-9-16(12-27-30-22(28-29-23(30)33)14-5-3-2-4-6-14)18(24)11-21(20)32-13-15-7-8-17(25)10-19(15)26/h2-11,27H,12-13H2,1H3,(H,29,33) |
| InChIKey | BIMJHXRXSLNNEK-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.31 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|