C23H20BrClN4O2S — CID 66545051
4-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 66545051) has the molecular formula C23H20BrClN4O2S and a molecular weight of 531.86 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 66545051 |
| Molecular Formula | C23H20BrClN4O2S |
| Molecular Weight | 531.86 g/mol |
| Exact Mass | 530.02 |
| IUPAC Name | 4-[[2-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cc(CNn2c(-c3ccccc3)n[nH]c2=S)c(Br)cc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20BrClN4O2S/c1-30-20-11-17(19(24)12-21(20)31-14-15-7-9-18(25)10-8-15)13-26-29-22(27-28-23(29)32)16-5-3-2-4-6-16/h2-12,26H,13-14H2,1H3,(H,28,32) |
| InChIKey | CYUAGYWSVOZMRJ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.86 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|